C9H18N2O2S — CID 116654802
N,N-diethyl-1-oxo-1,4-thiazinane-4-carboxamide (PubChem CID 116654802) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is N,N-diethyl-1-oxo-1,4-thiazinane-4-carboxamide.
| Compound Name | N,N-diethyl-1-oxo-1,4-thiazinane-4-carboxamide |
|---|---|
| PubChem CID | 116654802 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | N,N-diethyl-1-oxo-1,4-thiazinane-4-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCS(=O)CC1 |
| InChI | InChI=1S/C9H18N2O2S/c1-3-10(4-2)9(12)11-5-7-14(13)8-6-11/h3-8H2,1-2H3 |
| InChIKey | DMVHEOQLCDGVAH-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |