C12H25N3O3 — CID 174538699
(2S)-2-aminopropanoic acid;N,N-diethylpyrrolidine-1-carboxamide (PubChem CID 174538699) has the molecular formula C12H25N3O3 and a molecular weight of 259.35 g/mol. Its IUPAC name is (2S)-2-aminopropanoic acid;N,N-diethylpyrrolidine-1-carboxamide.
| Compound Name | (2S)-2-aminopropanoic acid;N,N-diethylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 174538699 |
| Molecular Formula | C12H25N3O3 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (2S)-2-aminopropanoic acid;N,N-diethylpyrrolidine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCCC1.C[C@H](N)C(=O)O |
| InChI | InChI=1S/C9H18N2O.C3H7NO2/c1-3-10(4-2)9(12)11-7-5-6-8-11;1-2(4)3(5)6/h3-8H2,1-2H3;2H,4H2,1H3,(H,5,6)/t;2-/m.0/s1 |
| InChIKey | WWJWLIFOWYFNOH-WNQIDUERSA-N |
| XLogP | 0.96 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |