C11H22N4OS — CID 79161963
4-(2-amino-2-sulfanylideneethyl)-N,N-diethylpiperazine-1-carboxamide (PubChem CID 79161963) has the molecular formula C11H22N4OS and a molecular weight of 258.39 g/mol. Its IUPAC name is 4-(2-amino-2-sulfanylideneethyl)-N,N-diethylpiperazine-1-carboxamide.
| Compound Name | 4-(2-amino-2-sulfanylideneethyl)-N,N-diethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 79161963 |
| Molecular Formula | C11H22N4OS |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 4-(2-amino-2-sulfanylideneethyl)-N,N-diethylpiperazine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCN(CC(N)=S)CC1 |
| InChI | InChI=1S/C11H22N4OS/c1-3-14(4-2)11(16)15-7-5-13(6-8-15)9-10(12)17/h3-9H2,1-2H3,(H2,12,17) |
| InChIKey | HELLUFVXXUEQBV-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|