C13H24N4OS — CID 63336169
2-[4-(2-amino-2-sulfanylideneethyl)piperazin-1-yl]-N-cyclopropyl-N-ethylacetamide (PubChem CID 63336169) has the molecular formula C13H24N4OS and a molecular weight of 284.43 g/mol. Its IUPAC name is 2-[4-(2-amino-2-sulfanylideneethyl)piperazin-1-yl]-N-cyclopropyl-N-ethylacetamide.
| Compound Name | 2-[4-(2-amino-2-sulfanylideneethyl)piperazin-1-yl]-N-cyclopropyl-N-ethylacetamide |
|---|---|
| PubChem CID | 63336169 |
| Molecular Formula | C13H24N4OS |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 2-[4-(2-amino-2-sulfanylideneethyl)piperazin-1-yl]-N-cyclopropyl-N-ethylacetamide |
| SMILES | CCN(C(=O)CN1CCN(CC(N)=S)CC1)C1CC1 |
| InChI | InChI=1S/C13H24N4OS/c1-2-17(11-3-4-11)13(18)10-16-7-5-15(6-8-16)9-12(14)19/h11H,2-10H2,1H3,(H2,14,19) |
| InChIKey | IUMDELGJKALYTA-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|