C12H26N4O — CID 79153561
4-(3-aminopropyl)-N,N-diethylpiperazine-1-carboxamide (PubChem CID 79153561) has the molecular formula C12H26N4O and a molecular weight of 242.37 g/mol. Its IUPAC name is 4-(3-aminopropyl)-N,N-diethylpiperazine-1-carboxamide.
| Compound Name | 4-(3-aminopropyl)-N,N-diethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 79153561 |
| Molecular Formula | C12H26N4O |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | 4-(3-aminopropyl)-N,N-diethylpiperazine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCN(CCCN)CC1 |
| InChI | InChI=1S/C12H26N4O/c1-3-15(4-2)12(17)16-10-8-14(9-11-16)7-5-6-13/h3-11,13H2,1-2H3 |
| InChIKey | MYOTYJLPJPPENB-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |