C13H27N3O — CID 108988508
4-ethyl-N,N-dipropylpiperazine-1-carboxamide (PubChem CID 108988508) has the molecular formula C13H27N3O and a molecular weight of 241.38 g/mol. Its IUPAC name is 4-ethyl-N,N-dipropylpiperazine-1-carboxamide.
| Compound Name | 4-ethyl-N,N-dipropylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 108988508 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | 4-ethyl-N,N-dipropylpiperazine-1-carboxamide |
| SMILES | CCCN(CCC)C(=O)N1CCN(CC)CC1 |
| InChI | InChI=1S/C13H27N3O/c1-4-7-15(8-5-2)13(17)16-11-9-14(6-3)10-12-16/h4-12H2,1-3H3 |
| InChIKey | PWALKIIXVZFKAD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |