C13H24N4O6 — CID 177187641
10-ethyl-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid (PubChem CID 177187641) has the molecular formula C13H24N4O6 and a molecular weight of 332.36 g/mol. Its IUPAC name is 10-ethyl-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid.
| Compound Name | 10-ethyl-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid |
|---|---|
| PubChem CID | 177187641 |
| Molecular Formula | C13H24N4O6 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 10-ethyl-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid |
| SMILES | CCN1CCN(C(=O)O)CCN(C(=O)O)CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C13H24N4O6/c1-2-14-3-5-15(11(18)19)7-9-17(13(22)23)10-8-16(6-4-14)12(20)21/h2-10H2,1H3,(H,18,19)(H,20,21)(H,22,23) |
| InChIKey | DQAWKVJEUKLOBJ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 124.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |