C24H54N6 — CID 66730221
1,4,7,10,13,16-hexaethyl-1,4,7,10,13,16-hexazacyclooctadecane (PubChem CID 66730221) has the molecular formula C24H54N6 and a molecular weight of 426.74 g/mol. Its IUPAC name is 1,4,7,10,13,16-hexaethyl-1,4,7,10,13,16-hexazacyclooctadecane.
| Compound Name | 1,4,7,10,13,16-hexaethyl-1,4,7,10,13,16-hexazacyclooctadecane |
|---|---|
| PubChem CID | 66730221 |
| Molecular Formula | C24H54N6 |
| Molecular Weight | 426.74 g/mol |
| Exact Mass | 426.44 |
| IUPAC Name | 1,4,7,10,13,16-hexaethyl-1,4,7,10,13,16-hexazacyclooctadecane |
| SMILES | CCN1CCN(CC)CCN(CC)CCN(CC)CCN(CC)CCN(CC)CC1 |
| InChI | InChI=1S/C24H54N6/c1-7-25-13-15-26(8-2)17-19-28(10-4)21-23-30(12-6)24-22-29(11-5)20-18-27(9-3)16-14-25/h7-24H2,1-6H3 |
| InChIKey | KDIWGOKDCFMBAP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 19.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.74 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |