C8H20N2S — CID 177062456
1,4-diethylpiperazine;sulfane (PubChem CID 177062456) has the molecular formula C8H20N2S and a molecular weight of 176.33 g/mol. Its IUPAC name is 1,4-diethylpiperazine;sulfane.
| Compound Name | 1,4-diethylpiperazine;sulfane |
|---|---|
| PubChem CID | 177062456 |
| Molecular Formula | C8H20N2S |
| Molecular Weight | 176.33 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1,4-diethylpiperazine;sulfane |
| SMILES | CCN1CCN(CC)CC1.S |
| InChI | InChI=1S/C8H18N2.H2S/c1-3-9-5-7-10(4-2)8-6-9;/h3-8H2,1-2H3;1H2 |
| InChIKey | MDFHELWNYKHNKR-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |