About 4-ethylpiperazin-1-amine
4-ethylpiperazin-1-amine (PubChem CID 3015725) has the molecular formula C6H15N3
and a molecular weight of 129.21 g/mol. Its IUPAC name is 4-ethylpiperazin-1-amine.
Molecular Properties
| Compound Name | 4-ethylpiperazin-1-amine |
| PubChem CID | 3015725 |
| Molecular Formula | C6H15N3 |
| Molecular Weight | 129.21 g/mol |
| Exact Mass | 129.13 |
| IUPAC Name | 4-ethylpiperazin-1-amine |
| SMILES | CCN1CCN(N)CC1 |
| InChI | InChI=1S/C6H15N3/c1-2-8-3-5-9(7)6-4-8/h2-7H2,1H3 |
| InChIKey | AHAPEYABSDOBIP-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.21 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylpiperazin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylpiperazin-1-amine?
The IUPAC name of 4-ethylpiperazin-1-amine (CID 3015725) is 4-ethylpiperazin-1-amine.
What is the SMILES notation for 4-ethylpiperazin-1-amine?
The canonical SMILES for 4-ethylpiperazin-1-amine is CCN1CCN(N)CC1.
What is the InChIKey of 4-ethylpiperazin-1-amine?
The InChIKey is AHAPEYABSDOBIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N3/c1-2-8-3-5-9(7)6-4-8/h2-7H2,1H3.
What are the key properties of 4-ethylpiperazin-1-amine?
4-ethylpiperazin-1-amine has a molecular weight of 129.21 g/mol, XLogP of -0.50, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylpiperazin-1-amine is sourced from PubChem (CID 3015725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).