C12H26N2 — CID 172611513
1,6-diethyl-1,6-diazecane (PubChem CID 172611513) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is 1,6-diethyl-1,6-diazecane.
| Compound Name | 1,6-diethyl-1,6-diazecane |
|---|---|
| PubChem CID | 172611513 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | 1,6-diethyl-1,6-diazecane |
| SMILES | CCN1CCCCN(CC)CCCC1 |
| InChI | InChI=1S/C12H26N2/c1-3-13-9-5-7-11-14(4-2)12-8-6-10-13/h3-12H2,1-2H3 |
| InChIKey | NRJOPSMWCUVKMW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |