C13H30N4 — CID 160568928
1,4-dimethylpiperazine;1-ethyl-4-methylpiperazine (PubChem CID 160568928) has the molecular formula C13H30N4 and a molecular weight of 242.41 g/mol. Its IUPAC name is 1,4-dimethylpiperazine;1-ethyl-4-methylpiperazine.
| Compound Name | 1,4-dimethylpiperazine;1-ethyl-4-methylpiperazine |
|---|---|
| PubChem CID | 160568928 |
| Molecular Formula | C13H30N4 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.25 |
| IUPAC Name | 1,4-dimethylpiperazine;1-ethyl-4-methylpiperazine |
| SMILES | CCN1CCN(C)CC1.CN1CCN(C)CC1 |
| InChI | InChI=1S/C7H16N2.C6H14N2/c1-3-9-6-4-8(2)5-7-9;1-7-3-5-8(2)6-4-7/h3-7H2,1-2H3;3-6H2,1-2H3 |
| InChIKey | RAHIRQQEHDVXQB-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |