C16H35N3 — CID 143157970
1,4-diethylpiperidine;1-ethyl-4-methylpiperazine (PubChem CID 143157970) has the molecular formula C16H35N3 and a molecular weight of 269.48 g/mol. Its IUPAC name is 1,4-diethylpiperidine;1-ethyl-4-methylpiperazine.
| Compound Name | 1,4-diethylpiperidine;1-ethyl-4-methylpiperazine |
|---|---|
| PubChem CID | 143157970 |
| Molecular Formula | C16H35N3 |
| Molecular Weight | 269.48 g/mol |
| Exact Mass | 269.28 |
| IUPAC Name | 1,4-diethylpiperidine;1-ethyl-4-methylpiperazine |
| SMILES | CCC1CCN(CC)CC1.CCN1CCN(C)CC1 |
| InChI | InChI=1S/C9H19N.C7H16N2/c1-3-9-5-7-10(4-2)8-6-9;1-3-9-6-4-8(2)5-7-9/h9H,3-8H2,1-2H3;3-7H2,1-2H3 |
| InChIKey | XFUNFOBIOJNYRJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |