C13H31N — CID 143709904
1,4-diethylpiperidine;ethane (PubChem CID 143709904) has the molecular formula C13H31N and a molecular weight of 201.40 g/mol. Its IUPAC name is 1,4-diethylpiperidine;ethane.
| Compound Name | 1,4-diethylpiperidine;ethane |
|---|---|
| PubChem CID | 143709904 |
| Molecular Formula | C13H31N |
| Molecular Weight | 201.40 g/mol |
| Exact Mass | 201.25 |
| IUPAC Name | 1,4-diethylpiperidine;ethane |
| SMILES | CC.CC.CCC1CCN(CC)CC1 |
| InChI | InChI=1S/C9H19N.2C2H6/c1-3-9-5-7-10(4-2)8-6-9;2*1-2/h9H,3-8H2,1-2H3;2*1-2H3 |
| InChIKey | MPWJZNGGIHUULB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |