C9H18N2 — CID 175874911
1,3-diethylpyrrolidine;formonitrile (PubChem CID 175874911) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 1,3-diethylpyrrolidine;formonitrile.
| Compound Name | 1,3-diethylpyrrolidine;formonitrile |
|---|---|
| PubChem CID | 175874911 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 1,3-diethylpyrrolidine;formonitrile |
| SMILES | C#N.CCC1CCN(CC)C1 |
| InChI | InChI=1S/C8H17N.CHN/c1-3-8-5-6-9(4-2)7-8;1-2/h8H,3-7H2,1-2H3;1H |
| InChIKey | INDPNCFWQDVUES-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |