C10H25N — CID 143628979
1,3-diethylpyrrolidine;ethane;molecular hydrogen (PubChem CID 143628979) has the molecular formula C10H25N and a molecular weight of 159.32 g/mol. Its IUPAC name is 1,3-diethylpyrrolidine;ethane;molecular hydrogen.
| Compound Name | 1,3-diethylpyrrolidine;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 143628979 |
| Molecular Formula | C10H25N |
| Molecular Weight | 159.32 g/mol |
| Exact Mass | 159.20 |
| IUPAC Name | 1,3-diethylpyrrolidine;ethane;molecular hydrogen |
| SMILES | CC.CCC1CCN(CC)C1.[H][H] |
| InChI | InChI=1S/C8H17N.C2H6.H2/c1-3-8-5-6-9(4-2)7-8;1-2;/h8H,3-7H2,1-2H3;1-2H3;1H |
| InChIKey | KXGJIXZHCICMAQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |