C10H23N — CID 145103245
1,3-diethylpyrrolidine;ethane (PubChem CID 145103245) has the molecular formula C10H23N and a molecular weight of 157.30 g/mol. Its IUPAC name is 1,3-diethylpyrrolidine;ethane.
| Compound Name | 1,3-diethylpyrrolidine;ethane |
|---|---|
| PubChem CID | 145103245 |
| Molecular Formula | C10H23N |
| Molecular Weight | 157.30 g/mol |
| Exact Mass | 157.18 |
| IUPAC Name | 1,3-diethylpyrrolidine;ethane |
| SMILES | CC.CCC1CCN(CC)C1 |
| InChI | InChI=1S/C8H17N.C2H6/c1-3-8-5-6-9(4-2)7-8;1-2/h8H,3-7H2,1-2H3;1-2H3 |
| InChIKey | SVIJDPKHYCRRCW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |