C10H21F2N — CID 169182399
1-(2,2-difluoroethyl)-3-ethylpyrrolidine;ethane (PubChem CID 169182399) has the molecular formula C10H21F2N and a molecular weight of 193.28 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-ethylpyrrolidine;ethane.
| Compound Name | 1-(2,2-difluoroethyl)-3-ethylpyrrolidine;ethane |
|---|---|
| PubChem CID | 169182399 |
| Molecular Formula | C10H21F2N |
| Molecular Weight | 193.28 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-ethylpyrrolidine;ethane |
| SMILES | CC.CCC1CCN(CC(F)F)C1 |
| InChI | InChI=1S/C8H15F2N.C2H6/c1-2-7-3-4-11(5-7)6-8(9)10;1-2/h7-8H,2-6H2,1H3;1-2H3 |
| InChIKey | ZAZPARJJPYWQPE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |