C12H23F2N — CID 167291149
1-(2,2-difluoroethyl)-4-pentan-2-ylpiperidine (PubChem CID 167291149) has the molecular formula C12H23F2N and a molecular weight of 219.32 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-4-pentan-2-ylpiperidine.
| Compound Name | 1-(2,2-difluoroethyl)-4-pentan-2-ylpiperidine |
|---|---|
| PubChem CID | 167291149 |
| Molecular Formula | C12H23F2N |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | 1-(2,2-difluoroethyl)-4-pentan-2-ylpiperidine |
| SMILES | CCCC(C)C1CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C12H23F2N/c1-3-4-10(2)11-5-7-15(8-6-11)9-12(13)14/h10-12H,3-9H2,1-2H3 |
| InChIKey | BLYHSJPJVDUHSW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |