About 1-(2,2-difluoroethyl)-N-propylpiperidin-4-amine;molecular hydrogen
1-(2,2-difluoroethyl)-N-propylpiperidin-4-amine;molecular hydrogen (PubChem CID 178010321) has the molecular formula C10H22F2N2
and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-N-propylpiperidin-4-amine;molecular hydrogen.
Molecular Properties
| Compound Name | 1-(2,2-difluoroethyl)-N-propylpiperidin-4-amine;molecular hydrogen |
| PubChem CID | 178010321 |
| Molecular Formula | C10H22F2N2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 1-(2,2-difluoroethyl)-N-propylpiperidin-4-amine;molecular hydrogen |
| SMILES | CCCNC1CCN(CC(F)F)CC1.[H][H] |
| InChI | InChI=1S/C10H20F2N2.H2/c1-2-5-13-9-3-6-14(7-4-9)8-10(11)12;/h9-10,13H,2-8H2,1H3;1H |
| InChIKey | AKMJCXMGNJKTRK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,2-difluoroethyl)-N-propylpiperidin-4-amine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoroethyl)-N-propylpiperidin-4-amine;molecular hydrogen?
The IUPAC name of 1-(2,2-difluoroethyl)-N-propylpiperidin-4-amine;molecular hydrogen (CID 178010321) is 1-(2,2-difluoroethyl)-N-propylpiperidin-4-amine;molecular hydrogen.
What is the SMILES notation for 1-(2,2-difluoroethyl)-N-propylpiperidin-4-amine;molecular hydrogen?
The canonical SMILES for 1-(2,2-difluoroethyl)-N-propylpiperidin-4-amine;molecular hydrogen is CCCNC1CCN(CC(F)F)CC1.[H][H].
What is the InChIKey of 1-(2,2-difluoroethyl)-N-propylpiperidin-4-amine;molecular hydrogen?
The InChIKey is AKMJCXMGNJKTRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20F2N2.H2/c1-2-5-13-9-3-6-14(7-4-9)8-10(11)12;/h9-10,13H,2-8H2,1H3;1H.
What are the key properties of 1-(2,2-difluoroethyl)-N-propylpiperidin-4-amine;molecular hydrogen?
1-(2,2-difluoroethyl)-N-propylpiperidin-4-amine;molecular hydrogen has a molecular weight of 208.30 g/mol, XLogP of 1.96, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroethyl)-N-propylpiperidin-4-amine;molecular hydrogen is sourced from PubChem (CID 178010321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).