About octan-2-ylcyclopropane
octan-2-ylcyclopropane (PubChem CID 18968125) has the molecular formula C11H22
and a molecular weight of 154.30 g/mol. Its IUPAC name is octan-2-ylcyclopropane.
Molecular Properties
| Compound Name | octan-2-ylcyclopropane |
| PubChem CID | 18968125 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.30 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | octan-2-ylcyclopropane |
| SMILES | CCCCCCC(C)C1CC1 |
| InChI | InChI=1S/C11H22/c1-3-4-5-6-7-10(2)11-8-9-11/h10-11H,3-9H2,1-2H3 |
| InChIKey | YFDREAKOTVNOOD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octan-2-ylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octan-2-ylcyclopropane?
The IUPAC name of octan-2-ylcyclopropane (CID 18968125) is octan-2-ylcyclopropane.
What is the SMILES notation for octan-2-ylcyclopropane?
The canonical SMILES for octan-2-ylcyclopropane is CCCCCCC(C)C1CC1.
What is the InChIKey of octan-2-ylcyclopropane?
The InChIKey is YFDREAKOTVNOOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22/c1-3-4-5-6-7-10(2)11-8-9-11/h10-11H,3-9H2,1-2H3.
What are the key properties of octan-2-ylcyclopropane?
octan-2-ylcyclopropane has a molecular weight of 154.30 g/mol, XLogP of 4.00, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for octan-2-ylcyclopropane is sourced from PubChem (CID 18968125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).