About 4-heptan-2-ylpiperidine
4-heptan-2-ylpiperidine (PubChem CID 143122379) has the molecular formula C12H25N
and a molecular weight of 183.34 g/mol. Its IUPAC name is 4-heptan-2-ylpiperidine.
Molecular Properties
| Compound Name | 4-heptan-2-ylpiperidine |
| PubChem CID | 143122379 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | 4-heptan-2-ylpiperidine |
| SMILES | CCCCCC(C)C1CCNCC1 |
| InChI | InChI=1S/C12H25N/c1-3-4-5-6-11(2)12-7-9-13-10-8-12/h11-13H,3-10H2,1-2H3 |
| InChIKey | UHCUYWZSUGQBSI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-heptan-2-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-heptan-2-ylpiperidine?
The IUPAC name of 4-heptan-2-ylpiperidine (CID 143122379) is 4-heptan-2-ylpiperidine.
What is the SMILES notation for 4-heptan-2-ylpiperidine?
The canonical SMILES for 4-heptan-2-ylpiperidine is CCCCCC(C)C1CCNCC1.
What is the InChIKey of 4-heptan-2-ylpiperidine?
The InChIKey is UHCUYWZSUGQBSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N/c1-3-4-5-6-11(2)12-7-9-13-10-8-12/h11-13H,3-10H2,1-2H3.
What are the key properties of 4-heptan-2-ylpiperidine?
4-heptan-2-ylpiperidine has a molecular weight of 183.34 g/mol, XLogP of 3.20, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-heptan-2-ylpiperidine is sourced from PubChem (CID 143122379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).