About 3-nonan-3-ylpyrrolidine
3-nonan-3-ylpyrrolidine (PubChem CID 146488434) has the molecular formula C13H27N
and a molecular weight of 197.37 g/mol. Its IUPAC name is 3-nonan-3-ylpyrrolidine.
Molecular Properties
| Compound Name | 3-nonan-3-ylpyrrolidine |
| PubChem CID | 146488434 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | 3-nonan-3-ylpyrrolidine |
| SMILES | CCCCCCC(CC)C1CCNC1 |
| InChI | InChI=1S/C13H27N/c1-3-5-6-7-8-12(4-2)13-9-10-14-11-13/h12-14H,3-11H2,1-2H3 |
| InChIKey | VBBAYCFVGNEYAY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-nonan-3-ylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nonan-3-ylpyrrolidine?
The IUPAC name of 3-nonan-3-ylpyrrolidine (CID 146488434) is 3-nonan-3-ylpyrrolidine.
What is the SMILES notation for 3-nonan-3-ylpyrrolidine?
The canonical SMILES for 3-nonan-3-ylpyrrolidine is CCCCCCC(CC)C1CCNC1.
What is the InChIKey of 3-nonan-3-ylpyrrolidine?
The InChIKey is VBBAYCFVGNEYAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N/c1-3-5-6-7-8-12(4-2)13-9-10-14-11-13/h12-14H,3-11H2,1-2H3.
What are the key properties of 3-nonan-3-ylpyrrolidine?
3-nonan-3-ylpyrrolidine has a molecular weight of 197.37 g/mol, XLogP of 3.59, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nonan-3-ylpyrrolidine is sourced from PubChem (CID 146488434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).