About nonan-3-ylcyclopentane
nonan-3-ylcyclopentane (PubChem CID 19893531) has the molecular formula C14H28
and a molecular weight of 196.38 g/mol. Its IUPAC name is nonan-3-ylcyclopentane.
Molecular Properties
| Compound Name | nonan-3-ylcyclopentane |
| PubChem CID | 19893531 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | nonan-3-ylcyclopentane |
| SMILES | CCCCCCC(CC)C1CCCC1 |
| InChI | InChI=1S/C14H28/c1-3-5-6-7-10-13(4-2)14-11-8-9-12-14/h13-14H,3-12H2,1-2H3 |
| InChIKey | PSFDQCTXYQHLQK-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze nonan-3-ylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonan-3-ylcyclopentane?
The IUPAC name of nonan-3-ylcyclopentane (CID 19893531) is nonan-3-ylcyclopentane.
What is the SMILES notation for nonan-3-ylcyclopentane?
The canonical SMILES for nonan-3-ylcyclopentane is CCCCCCC(CC)C1CCCC1.
What is the InChIKey of nonan-3-ylcyclopentane?
The InChIKey is PSFDQCTXYQHLQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28/c1-3-5-6-7-10-13(4-2)14-11-8-9-12-14/h13-14H,3-12H2,1-2H3.
What are the key properties of nonan-3-ylcyclopentane?
nonan-3-ylcyclopentane has a molecular weight of 196.38 g/mol, XLogP of 5.17, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for nonan-3-ylcyclopentane is sourced from PubChem (CID 19893531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).