About undecan-5-ylcyclohexane
undecan-5-ylcyclohexane (PubChem CID 524419) has the molecular formula C17H34
and a molecular weight of 238.46 g/mol. Its IUPAC name is undecan-5-ylcyclohexane.
Molecular Properties
| Compound Name | undecan-5-ylcyclohexane |
| PubChem CID | 524419 |
| Molecular Formula | C17H34 |
| Molecular Weight | 238.46 g/mol |
| Exact Mass | 238.27 |
| IUPAC Name | undecan-5-ylcyclohexane |
| SMILES | CCCCCCC(CCCC)C1CCCCC1 |
| InChI | InChI=1S/C17H34/c1-3-5-7-9-13-16(12-6-4-2)17-14-10-8-11-15-17/h16-17H,3-15H2,1-2H3 |
| InChIKey | BYZLRRVDPKPOEP-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 238.46 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze undecan-5-ylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undecan-5-ylcyclohexane?
The IUPAC name of undecan-5-ylcyclohexane (CID 524419) is undecan-5-ylcyclohexane.
What is the SMILES notation for undecan-5-ylcyclohexane?
The canonical SMILES for undecan-5-ylcyclohexane is CCCCCCC(CCCC)C1CCCCC1.
What is the InChIKey of undecan-5-ylcyclohexane?
The InChIKey is BYZLRRVDPKPOEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34/c1-3-5-7-9-13-16(12-6-4-2)17-14-10-8-11-15-17/h16-17H,3-15H2,1-2H3.
What are the key properties of undecan-5-ylcyclohexane?
undecan-5-ylcyclohexane has a molecular weight of 238.46 g/mol, XLogP of 6.34, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for undecan-5-ylcyclohexane is sourced from PubChem (CID 524419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).