About CID 22214505
CID 22214505 (PubChem CID 22214505) has the molecular formula C22H45OSi
and a molecular weight of 353.69 g/mol.
Molecular Properties
| Compound Name | CID 22214505 |
| PubChem CID | 22214505 |
| Molecular Formula | C22H45OSi |
| Molecular Weight | 353.69 g/mol |
| Exact Mass | 353.32 |
| IUPAC Name | — |
| SMILES | CCCCCCCCCCCC(CCO[Si](C)C)C1CCCCC1 |
| InChI | InChI=1S/C22H45OSi/c1-4-5-6-7-8-9-10-11-13-18-22(19-20-23-24(2)3)21-16-14-12-15-17-21/h21-22H,4-20H2,1-3H3 |
| InChIKey | WTJJXQUCTUXPHJ-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.69 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22214505 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22214505?
The IUPAC name of CID 22214505 (CID 22214505) is not available.
What is the SMILES notation for CID 22214505?
The canonical SMILES for CID 22214505 is CCCCCCCCCCCC(CCO[Si](C)C)C1CCCCC1.
What is the InChIKey of CID 22214505?
The InChIKey is WTJJXQUCTUXPHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H45OSi/c1-4-5-6-7-8-9-10-11-13-18-22(19-20-23-24(2)3)21-16-14-12-15-17-21/h21-22H,4-20H2,1-3H3.
What are the key properties of CID 22214505?
CID 22214505 has a molecular weight of 353.69 g/mol, XLogP of 7.76, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22214505 is sourced from PubChem (CID 22214505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).