About 6-cyclohexyldecyl carbamate
6-cyclohexyldecyl carbamate (PubChem CID 70556984) has the molecular formula C17H33NO2
and a molecular weight of 283.46 g/mol. Its IUPAC name is 6-cyclohexyldecyl carbamate.
Molecular Properties
| Compound Name | 6-cyclohexyldecyl carbamate |
| PubChem CID | 70556984 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | 6-cyclohexyldecyl carbamate |
| SMILES | CCCCC(CCCCCOC(N)=O)C1CCCCC1 |
| InChI | InChI=1S/C17H33NO2/c1-2-3-10-15(16-11-6-4-7-12-16)13-8-5-9-14-20-17(18)19/h15-16H,2-14H2,1H3,(H2,18,19) |
| InChIKey | VNTODLWHEZQBNB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-cyclohexyldecyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclohexyldecyl carbamate?
The IUPAC name of 6-cyclohexyldecyl carbamate (CID 70556984) is 6-cyclohexyldecyl carbamate.
What is the SMILES notation for 6-cyclohexyldecyl carbamate?
The canonical SMILES for 6-cyclohexyldecyl carbamate is CCCCC(CCCCCOC(N)=O)C1CCCCC1.
What is the InChIKey of 6-cyclohexyldecyl carbamate?
The InChIKey is VNTODLWHEZQBNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33NO2/c1-2-3-10-15(16-11-6-4-7-12-16)13-8-5-9-14-20-17(18)19/h15-16H,2-14H2,1H3,(H2,18,19).
What are the key properties of 6-cyclohexyldecyl carbamate?
6-cyclohexyldecyl carbamate has a molecular weight of 283.46 g/mol, XLogP of 5.03, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclohexyldecyl carbamate is sourced from PubChem (CID 70556984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).