C28H52O4 — CID 66984129
2-O-(9-methyldecyl) 1-O-nonyl cyclohexane-1,2-dicarboxylate (PubChem CID 66984129) has the molecular formula C28H52O4 and a molecular weight of 452.72 g/mol. Its IUPAC name is 2-O-(9-methyldecyl) 1-O-nonyl cyclohexane-1,2-dicarboxylate.
| Compound Name | 2-O-(9-methyldecyl) 1-O-nonyl cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 66984129 |
| Molecular Formula | C28H52O4 |
| Molecular Weight | 452.72 g/mol |
| Exact Mass | 452.39 |
| IUPAC Name | 2-O-(9-methyldecyl) 1-O-nonyl cyclohexane-1,2-dicarboxylate |
| SMILES | CCCCCCCCCOC(=O)C1CCCCC1C(=O)OCCCCCCCCC(C)C |
| InChI | InChI=1S/C28H52O4/c1-4-5-6-7-9-12-17-22-31-27(29)25-20-15-16-21-26(25)28(30)32-23-18-13-10-8-11-14-19-24(2)3/h24-26H,4-23H2,1-3H3 |
| InChIKey | NWTSZMHKMHAHES-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.72 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|