C26H48O4 — CID 11524680
bis(7-methyloctyl) cyclohexane-1,2-dicarboxylate (PubChem CID 11524680) has the molecular formula C26H48O4 and a molecular weight of 424.67 g/mol. Its IUPAC name is bis(7-methyloctyl) cyclohexane-1,2-dicarboxylate.
| Compound Name | bis(7-methyloctyl) cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11524680 |
| Molecular Formula | C26H48O4 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.36 |
| IUPAC Name | bis(7-methyloctyl) cyclohexane-1,2-dicarboxylate |
| SMILES | CC(C)CCCCCCOC(=O)C1CCCCC1C(=O)OCCCCCCC(C)C |
| InChI | InChI=1S/C26H48O4/c1-21(2)15-9-5-7-13-19-29-25(27)23-17-11-12-18-24(23)26(28)30-20-14-8-6-10-16-22(3)4/h21-24H,5-20H2,1-4H3 |
| InChIKey | HORIEOQXBKUKGQ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|