C24H44O4 — CID 66984027
2-O-(5-methylhexyl) 1-O-nonyl cyclohexane-1,2-dicarboxylate (PubChem CID 66984027) has the molecular formula C24H44O4 and a molecular weight of 396.61 g/mol. Its IUPAC name is 2-O-(5-methylhexyl) 1-O-nonyl cyclohexane-1,2-dicarboxylate.
| Compound Name | 2-O-(5-methylhexyl) 1-O-nonyl cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 66984027 |
| Molecular Formula | C24H44O4 |
| Molecular Weight | 396.61 g/mol |
| Exact Mass | 396.32 |
| IUPAC Name | 2-O-(5-methylhexyl) 1-O-nonyl cyclohexane-1,2-dicarboxylate |
| SMILES | CCCCCCCCCOC(=O)C1CCCCC1C(=O)OCCCCC(C)C |
| InChI | InChI=1S/C24H44O4/c1-4-5-6-7-8-9-13-18-27-23(25)21-16-10-11-17-22(21)24(26)28-19-14-12-15-20(2)3/h20-22H,4-19H2,1-3H3 |
| InChIKey | QHJQUEMMGJTTAE-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.61 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|