C43H78O8 — CID 152692056
1-O,2-O,4-O-tris(6-methylheptyl) 5-O-nonyl cyclohexane-1,2,4,5-tetracarboxylate (PubChem CID 152692056) has the molecular formula C43H78O8 and a molecular weight of 723.09 g/mol. Its IUPAC name is 1-O,2-O,4-O-tris(6-methylheptyl) 5-O-nonyl cyclohexane-1,2,4,5-tetracarboxylate.
| Compound Name | 1-O,2-O,4-O-tris(6-methylheptyl) 5-O-nonyl cyclohexane-1,2,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 152692056 |
| Molecular Formula | C43H78O8 |
| Molecular Weight | 723.09 g/mol |
| Exact Mass | 722.57 |
| IUPAC Name | 1-O,2-O,4-O-tris(6-methylheptyl) 5-O-nonyl cyclohexane-1,2,4,5-tetracarboxylate |
| SMILES | CCCCCCCCCOC(=O)C1CC(C(=O)OCCCCCC(C)C)C(C(=O)OCCCCCC(C)C)CC1C(=O)OCCCCCC(C)C |
| InChI | InChI=1S/C43H78O8/c1-8-9-10-11-12-13-20-27-48-40(44)36-31-38(42(46)50-29-22-15-18-25-34(4)5)39(43(47)51-30-23-16-19-26-35(6)7)32-37(36)41(45)49-28-21-14-17-24-33(2)3/h33-39H,8-32H2,1-7H3 |
| InChIKey | ZPTVKTFPPJTQRK-UHFFFAOYSA-N |
| XLogP | 10.82 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.09 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|