C46H84O8 — CID 23444148
2,4,5-tris(10-methylundecoxycarbonyl)cyclohexane-1-carboxylic acid (PubChem CID 23444148) has the molecular formula C46H84O8 and a molecular weight of 765.17 g/mol. Its IUPAC name is 2,4,5-tris(10-methylundecoxycarbonyl)cyclohexane-1-carboxylic acid.
| Compound Name | 2,4,5-tris(10-methylundecoxycarbonyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 23444148 |
| Molecular Formula | C46H84O8 |
| Molecular Weight | 765.17 g/mol |
| Exact Mass | 764.62 |
| IUPAC Name | 2,4,5-tris(10-methylundecoxycarbonyl)cyclohexane-1-carboxylic acid |
| SMILES | CC(C)CCCCCCCCCOC(=O)C1CC(C(=O)OCCCCCCCCCC(C)C)C(C(=O)OCCCCCCCCCC(C)C)CC1C(=O)O |
| InChI | InChI=1S/C46H84O8/c1-36(2)28-22-16-10-7-13-19-25-31-52-44(49)40-35-42(46(51)54-33-27-21-15-9-12-18-24-30-38(5)6)41(34-39(40)43(47)48)45(50)53-32-26-20-14-8-11-17-23-29-37(3)4/h36-42H,7-35H2,1-6H3,(H,47,48) |
| InChIKey | GREBHBHIDSJJIV-UHFFFAOYSA-N |
| XLogP | 12.29 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.17 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|