C19H32O4 — CID 69473448
6-(9-methyldecoxycarbonyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 69473448) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is 6-(9-methyldecoxycarbonyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-(9-methyldecoxycarbonyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 69473448 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 6-(9-methyldecoxycarbonyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | CC(C)CCCCCCCCOC(=O)C1CC=CCC1C(=O)O |
| InChI | InChI=1S/C19H32O4/c1-15(2)11-7-5-3-4-6-10-14-23-19(22)17-13-9-8-12-16(17)18(20)21/h8-9,15-17H,3-7,10-14H2,1-2H3,(H,20,21) |
| InChIKey | UQOPBSSNELUDEJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|