C43H78O8 — CID 66984685
2,4,5-tris(9-methyldecoxycarbonyl)cyclohexane-1-carboxylic acid (PubChem CID 66984685) has the molecular formula C43H78O8 and a molecular weight of 723.09 g/mol. Its IUPAC name is 2,4,5-tris(9-methyldecoxycarbonyl)cyclohexane-1-carboxylic acid.
| Compound Name | 2,4,5-tris(9-methyldecoxycarbonyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 66984685 |
| Molecular Formula | C43H78O8 |
| Molecular Weight | 723.09 g/mol |
| Exact Mass | 722.57 |
| IUPAC Name | 2,4,5-tris(9-methyldecoxycarbonyl)cyclohexane-1-carboxylic acid |
| SMILES | CC(C)CCCCCCCCOC(=O)C1CC(C(=O)OCCCCCCCCC(C)C)C(C(=O)OCCCCCCCCC(C)C)CC1C(=O)O |
| InChI | InChI=1S/C43H78O8/c1-33(2)25-19-13-7-10-16-22-28-49-41(46)37-32-39(43(48)51-30-24-18-12-9-15-21-27-35(5)6)38(31-36(37)40(44)45)42(47)50-29-23-17-11-8-14-20-26-34(3)4/h33-39H,7-32H2,1-6H3,(H,44,45) |
| InChIKey | QGKINPKBPGYPFM-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.09 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|