C24H40O8 — CID 66984559
4,6-bis(heptoxycarbonyl)cyclohexane-1,3-dicarboxylic acid (PubChem CID 66984559) has the molecular formula C24H40O8 and a molecular weight of 456.58 g/mol. Its IUPAC name is 4,6-bis(heptoxycarbonyl)cyclohexane-1,3-dicarboxylic acid.
| Compound Name | 4,6-bis(heptoxycarbonyl)cyclohexane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 66984559 |
| Molecular Formula | C24H40O8 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | 4,6-bis(heptoxycarbonyl)cyclohexane-1,3-dicarboxylic acid |
| SMILES | CCCCCCCOC(=O)C1CC(C(=O)OCCCCCCC)C(C(=O)O)CC1C(=O)O |
| InChI | InChI=1S/C24H40O8/c1-3-5-7-9-11-13-31-23(29)19-16-20(18(22(27)28)15-17(19)21(25)26)24(30)32-14-12-10-8-6-4-2/h17-20H,3-16H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | SRZJORGVOMSCAA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|