C19H32O6 — CID 151166538
4-decoxycarbonylcyclohexane-1,3-dicarboxylic acid (PubChem CID 151166538) has the molecular formula C19H32O6 and a molecular weight of 356.46 g/mol. Its IUPAC name is 4-decoxycarbonylcyclohexane-1,3-dicarboxylic acid.
| Compound Name | 4-decoxycarbonylcyclohexane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 151166538 |
| Molecular Formula | C19H32O6 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 4-decoxycarbonylcyclohexane-1,3-dicarboxylic acid |
| SMILES | CCCCCCCCCCOC(=O)C1CCC(C(=O)O)CC1C(=O)O |
| InChI | InChI=1S/C19H32O6/c1-2-3-4-5-6-7-8-9-12-25-19(24)15-11-10-14(17(20)21)13-16(15)18(22)23/h14-16H,2-13H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | NBJJGGJIDDHJMF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|