C21H36O6 — CID 66984817
2,3-bis(hexoxycarbonyl)cyclohexane-1-carboxylic acid (PubChem CID 66984817) has the molecular formula C21H36O6 and a molecular weight of 384.51 g/mol. Its IUPAC name is 2,3-bis(hexoxycarbonyl)cyclohexane-1-carboxylic acid.
| Compound Name | 2,3-bis(hexoxycarbonyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 66984817 |
| Molecular Formula | C21H36O6 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 2,3-bis(hexoxycarbonyl)cyclohexane-1-carboxylic acid |
| SMILES | CCCCCCOC(=O)C1CCCC(C(=O)O)C1C(=O)OCCCCCC |
| InChI | InChI=1S/C21H36O6/c1-3-5-7-9-14-26-20(24)17-13-11-12-16(19(22)23)18(17)21(25)27-15-10-8-6-4-2/h16-18H,3-15H2,1-2H3,(H,22,23) |
| InChIKey | OHIQMJSJLFESEG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|