2,3-bis(hexoxycarbonyl)cyclohexane-1-carboxylic acid

C21H36O6 — CID 66984817

IUPAC2,3-bis(hexoxycarbonyl)cyclohexane-1-carboxylic acid
SMILESCCCCCCOC(=O)C1CCCC(C(=O)O)C1C(=O)OCCCCCC
InChIInChI=1S/C21H36O6/c1-3-5-7-9-14-26-20(24)17-13-11-12-16(19(22)23)18(17)21(25)27-15-10-8-6-4-2/h16-18H,3-15H2,1-2H3,(H,22,23)
InChIKeyOHIQMJSJLFESEG-UHFFFAOYSA-N
MW384.51 g/mol
LogP4.35
Rot. Bonds13

About 2,3-bis(hexoxycarbonyl)cyclohexane-1-carboxylic acid

2,3-bis(hexoxycarbonyl)cyclohexane-1-carboxylic acid (PubChem CID 66984817) has the molecular formula C21H36O6 and a molecular weight of 384.51 g/mol. Its IUPAC name is 2,3-bis(hexoxycarbonyl)cyclohexane-1-carboxylic acid.

Molecular Properties

Compound Name2,3-bis(hexoxycarbonyl)cyclohexane-1-carboxylic acid
PubChem CID66984817
Molecular FormulaC21H36O6
Molecular Weight384.51 g/mol
Exact Mass384.25
IUPAC Name2,3-bis(hexoxycarbonyl)cyclohexane-1-carboxylic acid
SMILESCCCCCCOC(=O)C1CCCC(C(=O)O)C1C(=O)OCCCCCC
InChIInChI=1S/C21H36O6/c1-3-5-7-9-14-26-20(24)17-13-11-12-16(19(22)23)18(17)21(25)27-15-10-8-6-4-2/h16-18H,3-15H2,1-2H3,(H,22,23)
InChIKeyOHIQMJSJLFESEG-UHFFFAOYSA-N
XLogP4.35
TPSA89.90 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds13
Heavy Atoms27
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500384.51
LogP ≤ 54.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2,3-bis(hexoxycarbonyl)cyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-bis(hexoxycarbonyl)cyclohexane-1-carboxylic acid?
The IUPAC name of 2,3-bis(hexoxycarbonyl)cyclohexane-1-carboxylic acid (CID 66984817) is 2,3-bis(hexoxycarbonyl)cyclohexane-1-carboxylic acid.
What is the SMILES notation for 2,3-bis(hexoxycarbonyl)cyclohexane-1-carboxylic acid?
The canonical SMILES for 2,3-bis(hexoxycarbonyl)cyclohexane-1-carboxylic acid is CCCCCCOC(=O)C1CCCC(C(=O)O)C1C(=O)OCCCCCC.
What is the InChIKey of 2,3-bis(hexoxycarbonyl)cyclohexane-1-carboxylic acid?
The InChIKey is OHIQMJSJLFESEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H36O6/c1-3-5-7-9-14-26-20(24)17-13-11-12-16(19(22)23)18(17)21(25)27-15-10-8-6-4-2/h16-18H,3-15H2,1-2H3,(H,22,23).
What are the key properties of 2,3-bis(hexoxycarbonyl)cyclohexane-1-carboxylic acid?
2,3-bis(hexoxycarbonyl)cyclohexane-1-carboxylic acid has a molecular weight of 384.51 g/mol, XLogP of 4.35, 13 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(hexoxycarbonyl)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 66984817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).