2,3-bis(heptoxycarbonyl)cyclohexane-1-carboxylic acid

C23H40O6 — CID 66984548

IUPAC2,3-bis(heptoxycarbonyl)cyclohexane-1-carboxylic acid
SMILESCCCCCCCOC(=O)C1CCCC(C(=O)O)C1C(=O)OCCCCCCC
InChIInChI=1S/C23H40O6/c1-3-5-7-9-11-16-28-22(26)19-15-13-14-18(21(24)25)20(19)23(27)29-17-12-10-8-6-4-2/h18-20H,3-17H2,1-2H3,(H,24,25)
InChIKeyRZVUEGVTZSORGG-UHFFFAOYSA-N
MW412.57 g/mol
LogP5.13
Rot. Bonds15

About 2,3-bis(heptoxycarbonyl)cyclohexane-1-carboxylic acid

2,3-bis(heptoxycarbonyl)cyclohexane-1-carboxylic acid (PubChem CID 66984548) has the molecular formula C23H40O6 and a molecular weight of 412.57 g/mol. Its IUPAC name is 2,3-bis(heptoxycarbonyl)cyclohexane-1-carboxylic acid.

Molecular Properties

Compound Name2,3-bis(heptoxycarbonyl)cyclohexane-1-carboxylic acid
PubChem CID66984548
Molecular FormulaC23H40O6
Molecular Weight412.57 g/mol
Exact Mass412.28
IUPAC Name2,3-bis(heptoxycarbonyl)cyclohexane-1-carboxylic acid
SMILESCCCCCCCOC(=O)C1CCCC(C(=O)O)C1C(=O)OCCCCCCC
InChIInChI=1S/C23H40O6/c1-3-5-7-9-11-16-28-22(26)19-15-13-14-18(21(24)25)20(19)23(27)29-17-12-10-8-6-4-2/h18-20H,3-17H2,1-2H3,(H,24,25)
InChIKeyRZVUEGVTZSORGG-UHFFFAOYSA-N
XLogP5.13
TPSA89.90 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds15
Heavy Atoms29
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500412.57
LogP ≤ 55.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2,3-bis(heptoxycarbonyl)cyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-bis(heptoxycarbonyl)cyclohexane-1-carboxylic acid?
The IUPAC name of 2,3-bis(heptoxycarbonyl)cyclohexane-1-carboxylic acid (CID 66984548) is 2,3-bis(heptoxycarbonyl)cyclohexane-1-carboxylic acid.
What is the SMILES notation for 2,3-bis(heptoxycarbonyl)cyclohexane-1-carboxylic acid?
The canonical SMILES for 2,3-bis(heptoxycarbonyl)cyclohexane-1-carboxylic acid is CCCCCCCOC(=O)C1CCCC(C(=O)O)C1C(=O)OCCCCCCC.
What is the InChIKey of 2,3-bis(heptoxycarbonyl)cyclohexane-1-carboxylic acid?
The InChIKey is RZVUEGVTZSORGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H40O6/c1-3-5-7-9-11-16-28-22(26)19-15-13-14-18(21(24)25)20(19)23(27)29-17-12-10-8-6-4-2/h18-20H,3-17H2,1-2H3,(H,24,25).
What are the key properties of 2,3-bis(heptoxycarbonyl)cyclohexane-1-carboxylic acid?
2,3-bis(heptoxycarbonyl)cyclohexane-1-carboxylic acid has a molecular weight of 412.57 g/mol, XLogP of 5.13, 15 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(heptoxycarbonyl)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 66984548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).