About 4-octan-4-ylpiperidine
4-octan-4-ylpiperidine (PubChem CID 143122305) has the molecular formula C13H27N
and a molecular weight of 197.37 g/mol. Its IUPAC name is 4-octan-4-ylpiperidine.
Molecular Properties
| Compound Name | 4-octan-4-ylpiperidine |
| PubChem CID | 143122305 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | 4-octan-4-ylpiperidine |
| SMILES | CCCCC(CCC)C1CCNCC1 |
| InChI | InChI=1S/C13H27N/c1-3-5-7-12(6-4-2)13-8-10-14-11-9-13/h12-14H,3-11H2,1-2H3 |
| InChIKey | ODVOKVZFORRMFZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-octan-4-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-octan-4-ylpiperidine?
The IUPAC name of 4-octan-4-ylpiperidine (CID 143122305) is 4-octan-4-ylpiperidine.
What is the SMILES notation for 4-octan-4-ylpiperidine?
The canonical SMILES for 4-octan-4-ylpiperidine is CCCCC(CCC)C1CCNCC1.
What is the InChIKey of 4-octan-4-ylpiperidine?
The InChIKey is ODVOKVZFORRMFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N/c1-3-5-7-12(6-4-2)13-8-10-14-11-9-13/h12-14H,3-11H2,1-2H3.
What are the key properties of 4-octan-4-ylpiperidine?
4-octan-4-ylpiperidine has a molecular weight of 197.37 g/mol, XLogP of 3.59, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-octan-4-ylpiperidine is sourced from PubChem (CID 143122305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).