C16H28O4 — CID 174706332
8-octan-4-yl-1,5-dioxecane-2,4-dione (PubChem CID 174706332) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is 8-octan-4-yl-1,5-dioxecane-2,4-dione.
| Compound Name | 8-octan-4-yl-1,5-dioxecane-2,4-dione |
|---|---|
| PubChem CID | 174706332 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 8-octan-4-yl-1,5-dioxecane-2,4-dione |
| SMILES | CCCCC(CCC)C1CCOC(=O)CC(=O)OCC1 |
| InChI | InChI=1S/C16H28O4/c1-3-5-7-13(6-4-2)14-8-10-19-15(17)12-16(18)20-11-9-14/h13-14H,3-12H2,1-2H3 |
| InChIKey | GDHMCDXSHWWJOE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|