About 3-heptan-4-yloxolane
3-heptan-4-yloxolane (PubChem CID 162375259) has the molecular formula C11H22O
and a molecular weight of 170.30 g/mol. Its IUPAC name is 3-heptan-4-yloxolane.
Molecular Properties
| Compound Name | 3-heptan-4-yloxolane |
| PubChem CID | 162375259 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | 3-heptan-4-yloxolane |
| SMILES | CCCC(CCC)C1CCOC1 |
| InChI | InChI=1S/C11H22O/c1-3-5-10(6-4-2)11-7-8-12-9-11/h10-11H,3-9H2,1-2H3 |
| InChIKey | ABFPOWUOWWMBCN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-heptan-4-yloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-heptan-4-yloxolane?
The IUPAC name of 3-heptan-4-yloxolane (CID 162375259) is 3-heptan-4-yloxolane.
What is the SMILES notation for 3-heptan-4-yloxolane?
The canonical SMILES for 3-heptan-4-yloxolane is CCCC(CCC)C1CCOC1.
What is the InChIKey of 3-heptan-4-yloxolane?
The InChIKey is ABFPOWUOWWMBCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O/c1-3-5-10(6-4-2)11-7-8-12-9-11/h10-11H,3-9H2,1-2H3.
What are the key properties of 3-heptan-4-yloxolane?
3-heptan-4-yloxolane has a molecular weight of 170.30 g/mol, XLogP of 3.24, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-heptan-4-yloxolane is sourced from PubChem (CID 162375259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).