About 4-hexan-3-yloxane
4-hexan-3-yloxane (PubChem CID 118974929) has the molecular formula C11H22O
and a molecular weight of 170.30 g/mol. Its IUPAC name is 4-hexan-3-yloxane.
Molecular Properties
| Compound Name | 4-hexan-3-yloxane |
| PubChem CID | 118974929 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | 4-hexan-3-yloxane |
| SMILES | CCCC(CC)C1CCOCC1 |
| InChI | InChI=1S/C11H22O/c1-3-5-10(4-2)11-6-8-12-9-7-11/h10-11H,3-9H2,1-2H3 |
| InChIKey | INSDXVAUGRCGEJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-hexan-3-yloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexan-3-yloxane?
The IUPAC name of 4-hexan-3-yloxane (CID 118974929) is 4-hexan-3-yloxane.
What is the SMILES notation for 4-hexan-3-yloxane?
The canonical SMILES for 4-hexan-3-yloxane is CCCC(CC)C1CCOCC1.
What is the InChIKey of 4-hexan-3-yloxane?
The InChIKey is INSDXVAUGRCGEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O/c1-3-5-10(4-2)11-6-8-12-9-7-11/h10-11H,3-9H2,1-2H3.
What are the key properties of 4-hexan-3-yloxane?
4-hexan-3-yloxane has a molecular weight of 170.30 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexan-3-yloxane is sourced from PubChem (CID 118974929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).