C25H46N2O2 — CID 174641431
1-(2,3,3-trimethyl-7-piperidin-4-yltridecan-2-yl)pyrrolidine-2,5-dione (PubChem CID 174641431) has the molecular formula C25H46N2O2 and a molecular weight of 406.66 g/mol. Its IUPAC name is 1-(2,3,3-trimethyl-7-piperidin-4-yltridecan-2-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-(2,3,3-trimethyl-7-piperidin-4-yltridecan-2-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 174641431 |
| Molecular Formula | C25H46N2O2 |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 406.36 |
| IUPAC Name | 1-(2,3,3-trimethyl-7-piperidin-4-yltridecan-2-yl)pyrrolidine-2,5-dione |
| SMILES | CCCCCCC(CCCC(C)(C)C(C)(C)N1C(=O)CCC1=O)C1CCNCC1 |
| InChI | InChI=1S/C25H46N2O2/c1-6-7-8-9-11-20(21-15-18-26-19-16-21)12-10-17-24(2,3)25(4,5)27-22(28)13-14-23(27)29/h20-21,26H,6-19H2,1-5H3 |
| InChIKey | UGBHUJJHTATOAN-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|