C26H48N2O2 — CID 174296560
3-(2,3,3,4-tetramethyl-7-piperidin-4-yltridecan-2-yl)pyrrolidine-2,5-dione (PubChem CID 174296560) has the molecular formula C26H48N2O2 and a molecular weight of 420.68 g/mol. Its IUPAC name is 3-(2,3,3,4-tetramethyl-7-piperidin-4-yltridecan-2-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-(2,3,3,4-tetramethyl-7-piperidin-4-yltridecan-2-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 174296560 |
| Molecular Formula | C26H48N2O2 |
| Molecular Weight | 420.68 g/mol |
| Exact Mass | 420.37 |
| IUPAC Name | 3-(2,3,3,4-tetramethyl-7-piperidin-4-yltridecan-2-yl)pyrrolidine-2,5-dione |
| SMILES | CCCCCCC(CCC(C)C(C)(C)C(C)(C)C1CC(=O)NC1=O)C1CCNCC1 |
| InChI | InChI=1S/C26H48N2O2/c1-7-8-9-10-11-20(21-14-16-27-17-15-21)13-12-19(2)25(3,4)26(5,6)22-18-23(29)28-24(22)30/h19-22,27H,7-18H2,1-6H3,(H,28,29,30) |
| InChIKey | ZEMMPCWUQJGCKO-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.68 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|