C19H35NO2S — CID 139407148
3-pentadecan-8-ylsulfanylpyrrolidine-2,5-dione (PubChem CID 139407148) has the molecular formula C19H35NO2S and a molecular weight of 341.56 g/mol. Its IUPAC name is 3-pentadecan-8-ylsulfanylpyrrolidine-2,5-dione.
| Compound Name | 3-pentadecan-8-ylsulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 139407148 |
| Molecular Formula | C19H35NO2S |
| Molecular Weight | 341.56 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | 3-pentadecan-8-ylsulfanylpyrrolidine-2,5-dione |
| SMILES | CCCCCCCC(CCCCCCC)SC1CC(=O)NC1=O |
| InChI | InChI=1S/C19H35NO2S/c1-3-5-7-9-11-13-16(14-12-10-8-6-4-2)23-17-15-18(21)20-19(17)22/h16-17H,3-15H2,1-2H3,(H,20,21,22) |
| InChIKey | DHGCESAAPZDHPX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|