C12H21NO2 — CID 172620709
3-(2-ethylhexyl)pyrrolidine-2,5-dione (PubChem CID 172620709) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 3-(2-ethylhexyl)pyrrolidine-2,5-dione.
| Compound Name | 3-(2-ethylhexyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 172620709 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 3-(2-ethylhexyl)pyrrolidine-2,5-dione |
| SMILES | CCCCC(CC)CC1CC(=O)NC1=O |
| InChI | InChI=1S/C12H21NO2/c1-3-5-6-9(4-2)7-10-8-11(14)13-12(10)15/h9-10H,3-8H2,1-2H3,(H,13,14,15) |
| InChIKey | NAAXETGRSHZBBY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|