About 3-hexylpyrrolidine-2,5-dione;hydrochloride
3-hexylpyrrolidine-2,5-dione;hydrochloride (PubChem CID 70281671) has the molecular formula C10H18ClNO2
and a molecular weight of 219.71 g/mol. Its IUPAC name is 3-hexylpyrrolidine-2,5-dione;hydrochloride.
Molecular Properties
| Compound Name | 3-hexylpyrrolidine-2,5-dione;hydrochloride |
| PubChem CID | 70281671 |
| Molecular Formula | C10H18ClNO2 |
| Molecular Weight | 219.71 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 3-hexylpyrrolidine-2,5-dione;hydrochloride |
| SMILES | CCCCCCC1CC(=O)NC1=O.Cl |
| InChI | InChI=1S/C10H17NO2.ClH/c1-2-3-4-5-6-8-7-9(12)11-10(8)13;/h8H,2-7H2,1H3,(H,11,12,13);1H |
| InChIKey | ATYLQJHZMOASKL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.71 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-hexylpyrrolidine-2,5-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexylpyrrolidine-2,5-dione;hydrochloride?
The IUPAC name of 3-hexylpyrrolidine-2,5-dione;hydrochloride (CID 70281671) is 3-hexylpyrrolidine-2,5-dione;hydrochloride.
What is the SMILES notation for 3-hexylpyrrolidine-2,5-dione;hydrochloride?
The canonical SMILES for 3-hexylpyrrolidine-2,5-dione;hydrochloride is CCCCCCC1CC(=O)NC1=O.Cl.
What is the InChIKey of 3-hexylpyrrolidine-2,5-dione;hydrochloride?
The InChIKey is ATYLQJHZMOASKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2.ClH/c1-2-3-4-5-6-8-7-9(12)11-10(8)13;/h8H,2-7H2,1H3,(H,11,12,13);1H.
What are the key properties of 3-hexylpyrrolidine-2,5-dione;hydrochloride?
3-hexylpyrrolidine-2,5-dione;hydrochloride has a molecular weight of 219.71 g/mol, XLogP of 2.04, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexylpyrrolidine-2,5-dione;hydrochloride is sourced from PubChem (CID 70281671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).