C20H35NO2 — CID 23513051
3-[(E)-hexadec-1-enyl]pyrrolidine-2,5-dione (PubChem CID 23513051) has the molecular formula C20H35NO2 and a molecular weight of 321.51 g/mol. Its IUPAC name is 3-[(E)-hexadec-1-enyl]pyrrolidine-2,5-dione.
| Compound Name | 3-[(E)-hexadec-1-enyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 23513051 |
| Molecular Formula | C20H35NO2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.27 |
| IUPAC Name | 3-[(E)-hexadec-1-enyl]pyrrolidine-2,5-dione |
| SMILES | CCCCCCCCCCCCCC/C=C/C1CC(=O)NC1=O |
| InChI | InChI=1S/C20H35NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-17-19(22)21-20(18)23/h15-16,18H,2-14,17H2,1H3,(H,21,22,23)/b16-15+ |
| InChIKey | LSRSRCQYIXWQLA-FOCLMDBBSA-N |
| XLogP | 5.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|