C7H9NO2 — CID 21217415
3-[(E)-prop-1-enyl]pyrrolidine-2,5-dione (PubChem CID 21217415) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is 3-[(E)-prop-1-enyl]pyrrolidine-2,5-dione.
| Compound Name | 3-[(E)-prop-1-enyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 21217415 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 3-[(E)-prop-1-enyl]pyrrolidine-2,5-dione |
| SMILES | C/C=C/C1CC(=O)NC1=O |
| InChI | InChI=1S/C7H9NO2/c1-2-3-5-4-6(9)8-7(5)10/h2-3,5H,4H2,1H3,(H,8,9,10)/b3-2+ |
| InChIKey | GKKMLVLCXQTJCX-NSCUHMNNSA-N |
| XLogP | 0.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|