C31H50O6 — CID 87423856
3-[(E)-dodec-1-enyl]oxolane-2,5-dione;3-[(E)-undec-1-enyl]oxolane-2,5-dione (PubChem CID 87423856) has the molecular formula C31H50O6 and a molecular weight of 518.74 g/mol. Its IUPAC name is 3-[(E)-dodec-1-enyl]oxolane-2,5-dione;3-[(E)-undec-1-enyl]oxolane-2,5-dione.
| Compound Name | 3-[(E)-dodec-1-enyl]oxolane-2,5-dione;3-[(E)-undec-1-enyl]oxolane-2,5-dione |
|---|---|
| PubChem CID | 87423856 |
| Molecular Formula | C31H50O6 |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.36 |
| IUPAC Name | 3-[(E)-dodec-1-enyl]oxolane-2,5-dione;3-[(E)-undec-1-enyl]oxolane-2,5-dione |
| SMILES | CCCCCCCCC/C=C/C1CC(=O)OC1=O.CCCCCCCCCC/C=C/C1CC(=O)OC1=O |
| InChI | InChI=1S/C16H26O3.C15H24O3/c1-2-3-4-5-6-7-8-9-10-11-12-14-13-15(17)19-16(14)18;1-2-3-4-5-6-7-8-9-10-11-13-12-14(16)18-15(13)17/h11-12,14H,2-10,13H2,1H3;10-11,13H,2-9,12H2,1H3/b12-11+;11-10+ |
| InChIKey | RXQAQOFAIDLJMC-CXJFYUDPSA-N |
| XLogP | 7.94 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|